C16H18N2O4S2 — CID 56909651
1-(4-methoxyphenyl)-3-methyl-4-thiophen-3-ylsulfonylpiperazin-2-one (PubChem CID 56909651) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-methyl-4-thiophen-3-ylsulfonylpiperazin-2-one.
| Compound Name | 1-(4-methoxyphenyl)-3-methyl-4-thiophen-3-ylsulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 56909651 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-methyl-4-thiophen-3-ylsulfonylpiperazin-2-one |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3ccsc3)C(C)C2=O)cc1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-12-16(19)17(13-3-5-14(22-2)6-4-13)8-9-18(12)24(20,21)15-7-10-23-11-15/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | SSCLLDPTPGVIGR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |