C21H20Cl2N3O2+ — CID 1397853
2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 1397853) has the molecular formula C21H20Cl2N3O2+ and a molecular weight of 417.32 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1397853 |
| Molecular Formula | C21H20Cl2N3O2+ |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)C[n+]2cc(-c3ccc(Cl)c(Cl)c3)n3c2CCC3)c1 |
| InChI | InChI=1S/C21H19Cl2N3O2/c1-28-16-5-2-4-15(11-16)24-20(27)13-25-12-19(26-9-3-6-21(25)26)14-7-8-17(22)18(23)10-14/h2,4-5,7-8,10-12H,3,6,9,13H2,1H3/p+1 |
| InChIKey | BTLAYKDQUVMCTK-UHFFFAOYSA-O |
| XLogP | 4.34 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|