C25H30ClN3O2 — CID 44663216
N-(4-butylphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride (PubChem CID 44663216) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride.
| Compound Name | N-(4-butylphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride |
|---|---|
| PubChem CID | 44663216 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-(4-butylphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide chloride |
| SMILES | CCCCc1ccc(NC(=O)C[n+]2cc(-c3ccc(OC)cc3)n3c2CCC3)cc1.[Cl-] |
| InChI | InChI=1S/C25H29N3O2.ClH/c1-3-4-6-19-8-12-21(13-9-19)26-24(29)18-27-17-23(28-16-5-7-25(27)28)20-10-14-22(30-2)15-11-20;/h8-15,17H,3-7,16,18H2,1-2H3;1H |
| InChIKey | MHEBQSNFURXQAS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|