C23H23ClN3O3+ — CID 1415194
ethyl 4-[[2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetyl]amino]benzoate (PubChem CID 1415194) has the molecular formula C23H23ClN3O3+ and a molecular weight of 424.91 g/mol. Its IUPAC name is ethyl 4-[[2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 1415194 |
| Molecular Formula | C23H23ClN3O3+ |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | ethyl 4-[[2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[n+]2cc(-c3ccc(Cl)cc3)n3c2CCC3)cc1 |
| InChI | InChI=1S/C23H22ClN3O3/c1-2-30-23(29)17-7-11-19(12-8-17)25-21(28)15-26-14-20(27-13-3-4-22(26)27)16-5-9-18(24)10-6-16/h5-12,14H,2-4,13,15H2,1H3/p+1 |
| InChIKey | BMKCDTGQOBEURS-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|