C20H18F2N3O+ — CID 2010861
N-(2-fluorophenyl)-2-[3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide (PubChem CID 2010861) has the molecular formula C20H18F2N3O+ and a molecular weight of 354.38 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2010861 |
| Molecular Formula | C20H18F2N3O+ |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(2-fluorophenyl)-2-[3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide |
| SMILES | O=C(C[n+]1cc(-c2ccc(F)cc2)n2c1CCC2)Nc1ccccc1F |
| InChI | InChI=1S/C20H17F2N3O/c21-15-9-7-14(8-10-15)18-12-24(20-6-3-11-25(18)20)13-19(26)23-17-5-2-1-4-16(17)22/h1-2,4-5,7-10,12H,3,6,11,13H2/p+1 |
| InChIKey | QQULQNUQWAQEKF-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|