C21H19ClN3O3+ — CID 34637926
N-(1,3-benzodioxol-5-yl)-2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide (PubChem CID 34637926) has the molecular formula C21H19ClN3O3+ and a molecular weight of 396.85 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 34637926 |
| Molecular Formula | C21H19ClN3O3+ |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]acetamide |
| SMILES | O=C(C[n+]1cc(-c2ccc(Cl)cc2)n2c1CCC2)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H18ClN3O3/c22-15-5-3-14(4-6-15)17-11-24(21-2-1-9-25(17)21)12-20(26)23-16-7-8-18-19(10-16)28-13-27-18/h3-8,10-11H,1-2,9,12-13H2/p+1 |
| InChIKey | UZJWXTLNHRZOFU-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|