C15H13ClN2O5S — CID 1210774
N-(1,3-benzodioxol-5-yl)-2-[(4-chlorophenyl)sulfonylamino]acetamide (PubChem CID 1210774) has the molecular formula C15H13ClN2O5S and a molecular weight of 368.80 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(4-chlorophenyl)sulfonylamino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(4-chlorophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 1210774 |
| Molecular Formula | C15H13ClN2O5S |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(4-chlorophenyl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Cl)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13ClN2O5S/c16-10-1-4-12(5-2-10)24(20,21)17-8-15(19)18-11-3-6-13-14(7-11)23-9-22-13/h1-7,17H,8-9H2,(H,18,19) |
| InChIKey | KGHRGXDYLFUSCZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |