C16H14N2O7S — CID 110606353
3-[[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfamoyl]benzoic acid (PubChem CID 110606353) has the molecular formula C16H14N2O7S and a molecular weight of 378.36 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 110606353 |
| Molecular Formula | C16H14N2O7S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfamoyl]benzoic acid |
| SMILES | O=C(CNS(=O)(=O)c1cccc(C(=O)O)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14N2O7S/c19-15(18-11-4-5-13-14(7-11)25-9-24-13)8-17-26(22,23)12-3-1-2-10(6-12)16(20)21/h1-7,17H,8-9H2,(H,18,19)(H,20,21) |
| InChIKey | ZHZAZPHTZSPTEB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |