C14H14Cl3N3O — CID 131666399
2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride (PubChem CID 131666399) has the molecular formula C14H14Cl3N3O and a molecular weight of 346.65 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride |
|---|---|
| PubChem CID | 131666399 |
| Molecular Formula | C14H14Cl3N3O |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\[O-])C[n+]1cc(-c2ccc(Cl)c(Cl)c2)n2c1CCC2 |
| InChI | InChI=1S/C14H13Cl2N3O.ClH/c15-10-4-3-9(6-11(10)16)12-7-18(8-13(17)20)14-2-1-5-19(12)14;/h3-4,6-7H,1-2,5,8H2,(H-,17,20);1H |
| InChIKey | RRGLKVGVNDKIKF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|