C24H27N2O2+ — CID 4888238
1-(4-ethoxyphenyl)-2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]propan-1-one (PubChem CID 4888238) has the molecular formula C24H27N2O2+ and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]propan-1-one.
| Compound Name | 1-(4-ethoxyphenyl)-2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]propan-1-one |
|---|---|
| PubChem CID | 4888238 |
| Molecular Formula | C24H27N2O2+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]propan-1-one |
| SMILES | CCOc1ccc(C(=O)C(C)[n+]2cc(-c3ccc(C)cc3)n3c2CCC3)cc1 |
| InChI | InChI=1S/C24H27N2O2/c1-4-28-21-13-11-20(12-14-21)24(27)18(3)26-16-22(25-15-5-6-23(25)26)19-9-7-17(2)8-10-19/h7-14,16,18H,4-6,15H2,1-3H3/q+1 |
| InChIKey | UJZRQRRYMUWIKS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|