C19H17BrN3O3+ — CID 5021987
2-[2-amino-4-(3-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(1,3-benzodioxol-5-yl)ethanone (PubChem CID 5021987) has the molecular formula C19H17BrN3O3+ and a molecular weight of 415.27 g/mol. Its IUPAC name is 2-[2-amino-4-(3-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(1,3-benzodioxol-5-yl)ethanone.
| Compound Name | 2-[2-amino-4-(3-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(1,3-benzodioxol-5-yl)ethanone |
|---|---|
| PubChem CID | 5021987 |
| Molecular Formula | C19H17BrN3O3+ |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 2-[2-amino-4-(3-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(1,3-benzodioxol-5-yl)ethanone |
| SMILES | Cn1c(-c2cccc(Br)c2)c[n+](CC(=O)c2ccc3c(c2)OCO3)c1N |
| InChI | InChI=1S/C19H16BrN3O3/c1-22-15(12-3-2-4-14(20)7-12)9-23(19(22)21)10-16(24)13-5-6-17-18(8-13)26-11-25-17/h2-9,21H,10-11H2,1H3/p+1 |
| InChIKey | RCTDGHPKLNINPQ-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|