C25H22BrN3O3 — CID 163327664
2-[2-amino-4-(1,3-benzodioxol-5-yl)-3-methylimidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone bromide (PubChem CID 163327664) has the molecular formula C25H22BrN3O3 and a molecular weight of 492.37 g/mol. Its IUPAC name is 2-[2-amino-4-(1,3-benzodioxol-5-yl)-3-methylimidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone bromide.
| Compound Name | 2-[2-amino-4-(1,3-benzodioxol-5-yl)-3-methylimidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone bromide |
|---|---|
| PubChem CID | 163327664 |
| Molecular Formula | C25H22BrN3O3 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 2-[2-amino-4-(1,3-benzodioxol-5-yl)-3-methylimidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone bromide |
| SMILES | Cn1c(-c2ccc3c(c2)OCO3)c[n+](CC(=O)c2ccc(-c3ccccc3)cc2)c1N.[Br-] |
| InChI | InChI=1S/C25H21N3O3.BrH/c1-27-21(20-11-12-23-24(13-20)31-16-30-23)14-28(25(27)26)15-22(29)19-9-7-18(8-10-19)17-5-3-2-4-6-17;/h2-14,26H,15-16H2,1H3;1H |
| InChIKey | MYYPXCFSYPFLEP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|