C26H25NO3 — CID 18281010
N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentyl-4-phenylbenzamide (PubChem CID 18281010) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentyl-4-phenylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentyl-4-phenylbenzamide |
|---|---|
| PubChem CID | 18281010 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentyl-4-phenylbenzamide |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N(Cc1ccc2c(c1)OCO2)C1CCCC1 |
| InChI | InChI=1S/C26H25NO3/c28-26(22-13-11-21(12-14-22)20-6-2-1-3-7-20)27(23-8-4-5-9-23)17-19-10-15-24-25(16-19)30-18-29-24/h1-3,6-7,10-16,23H,4-5,8-9,17-18H2 |
| InChIKey | PMYYMNQBGJHYSD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |