C23H27NO3 — CID 42723798
N-(1,3-benzodioxol-5-ylmethyl)-N-cyclohexyl-3-phenylpropanamide (PubChem CID 42723798) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 42723798 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)N(Cc1ccc2c(c1)OCO2)C1CCCCC1 |
| InChI | InChI=1S/C23H27NO3/c25-23(14-12-18-7-3-1-4-8-18)24(20-9-5-2-6-10-20)16-19-11-13-21-22(15-19)27-17-26-21/h1,3-4,7-8,11,13,15,20H,2,5-6,9-10,12,14,16-17H2 |
| InChIKey | AWHUFEJXYCJHLT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |