C21H31NO3 — CID 42723814
N-(1,3-benzodioxol-5-ylmethyl)-N-cyclohexylheptanamide (PubChem CID 42723814) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-cyclohexylheptanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclohexylheptanamide |
|---|---|
| PubChem CID | 42723814 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclohexylheptanamide |
| SMILES | CCCCCCC(=O)N(Cc1ccc2c(c1)OCO2)C1CCCCC1 |
| InChI | InChI=1S/C21H31NO3/c1-2-3-4-8-11-21(23)22(18-9-6-5-7-10-18)15-17-12-13-19-20(14-17)25-16-24-19/h12-14,18H,2-11,15-16H2,1H3 |
| InChIKey | MDFLXYFHAUDGLJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|