C27H25NO7 — CID 67398301
[5-[4-[[1,3-benzodioxole-5-carbonyl(cyclopentyl)amino]methyl]phenyl]-2-hydroxyphenyl] hydrogen carbonate (PubChem CID 67398301) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is [5-[4-[[1,3-benzodioxole-5-carbonyl(cyclopentyl)amino]methyl]phenyl]-2-hydroxyphenyl] hydrogen carbonate.
| Compound Name | [5-[4-[[1,3-benzodioxole-5-carbonyl(cyclopentyl)amino]methyl]phenyl]-2-hydroxyphenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67398301 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [5-[4-[[1,3-benzodioxole-5-carbonyl(cyclopentyl)amino]methyl]phenyl]-2-hydroxyphenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cc(-c2ccc(CN(C(=O)c3ccc4c(c3)OCO4)C3CCCC3)cc2)ccc1O |
| InChI | InChI=1S/C27H25NO7/c29-22-11-9-19(13-24(22)35-27(31)32)18-7-5-17(6-8-18)15-28(21-3-1-2-4-21)26(30)20-10-12-23-25(14-20)34-16-33-23/h5-14,21,29H,1-4,15-16H2,(H,31,32) |
| InChIKey | AZSBCQDTJQFNIJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|