C23H22N2O3 — CID 18190249
N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentylquinoline-2-carboxamide (PubChem CID 18190249) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentylquinoline-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 18190249 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentylquinoline-2-carboxamide |
| SMILES | O=C(c1ccc2ccccc2n1)N(Cc1ccc2c(c1)OCO2)C1CCCC1 |
| InChI | InChI=1S/C23H22N2O3/c26-23(20-11-10-17-5-1-4-8-19(17)24-20)25(18-6-2-3-7-18)14-16-9-12-21-22(13-16)28-15-27-21/h1,4-5,8-13,18H,2-3,6-7,14-15H2 |
| InChIKey | RICIJJWPFIZALY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |