C17H19ClN2O — CID 102872000
N-(3-chloropropyl)-N-cyclobutylquinoline-2-carboxamide (PubChem CID 102872000) has the molecular formula C17H19ClN2O and a molecular weight of 302.80 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-cyclobutylquinoline-2-carboxamide.
| Compound Name | N-(3-chloropropyl)-N-cyclobutylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 102872000 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-(3-chloropropyl)-N-cyclobutylquinoline-2-carboxamide |
| SMILES | O=C(c1ccc2ccccc2n1)N(CCCCl)C1CCC1 |
| InChI | InChI=1S/C17H19ClN2O/c18-11-4-12-20(14-6-3-7-14)17(21)16-10-9-13-5-1-2-8-15(13)19-16/h1-2,5,8-10,14H,3-4,6-7,11-12H2 |
| InChIKey | VTFJRHJPBYQGQV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|