C14H13ClF2N2O — CID 107491243
N-(2-chloroethyl)-N-(2,2-difluoroethyl)quinoline-2-carboxamide (PubChem CID 107491243) has the molecular formula C14H13ClF2N2O and a molecular weight of 298.72 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)quinoline-2-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 107491243 |
| Molecular Formula | C14H13ClF2N2O |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)quinoline-2-carboxamide |
| SMILES | O=C(c1ccc2ccccc2n1)N(CCCl)CC(F)F |
| InChI | InChI=1S/C14H13ClF2N2O/c15-7-8-19(9-13(16)17)14(20)12-6-5-10-3-1-2-4-11(10)18-12/h1-6,13H,7-9H2 |
| InChIKey | CCTGZNMTDJSIPU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|