C10H13ClF2N2O3 — CID 107490905
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 107490905) has the molecular formula C10H13ClF2N2O3 and a molecular weight of 282.67 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 107490905 |
| Molecular Formula | C10H13ClF2N2O3 |
| Molecular Weight | 282.67 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)N(CCCl)CC(F)F)no1 |
| InChI | InChI=1S/C10H13ClF2N2O3/c1-17-6-7-4-8(14-18-7)10(16)15(3-2-11)5-9(12)13/h4,9H,2-3,5-6H2,1H3 |
| InChIKey | LQZRMTORVRSEAX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.67 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|