C7H9ClN2O2 — CID 118543057
5-(chloromethyl)-N,N-dimethyl-1,2-oxazole-3-carboxamide (PubChem CID 118543057) has the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. Its IUPAC name is 5-(chloromethyl)-N,N-dimethyl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(chloromethyl)-N,N-dimethyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 118543057 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 5-(chloromethyl)-N,N-dimethyl-1,2-oxazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1cc(CCl)on1 |
| InChI | InChI=1S/C7H9ClN2O2/c1-10(2)7(11)6-3-5(4-8)12-9-6/h3H,4H2,1-2H3 |
| InChIKey | NLBQUWJSEJRKAN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|