C6H6ClNO3 — CID 158373932
1-[5-(chloromethyl)-1,2-oxazol-3-yl]-2-hydroxyethanone (PubChem CID 158373932) has the molecular formula C6H6ClNO3 and a molecular weight of 175.57 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-1,2-oxazol-3-yl]-2-hydroxyethanone.
| Compound Name | 1-[5-(chloromethyl)-1,2-oxazol-3-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 158373932 |
| Molecular Formula | C6H6ClNO3 |
| Molecular Weight | 175.57 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | 1-[5-(chloromethyl)-1,2-oxazol-3-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)c1cc(CCl)on1 |
| InChI | InChI=1S/C6H6ClNO3/c7-2-4-1-5(8-11-4)6(10)3-9/h1,9H,2-3H2 |
| InChIKey | DLJFPAHJHUXNNZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.57 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|