C11H10ClN3O3 — CID 63577021
5-[(2-chlorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63577021) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is 5-[(2-chlorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[(2-chlorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63577021 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 5-[(2-chlorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | NNC(=O)c1cc(COc2ccccc2Cl)on1 |
| InChI | InChI=1S/C11H10ClN3O3/c12-8-3-1-2-4-10(8)17-6-7-5-9(15-18-7)11(16)14-13/h1-5H,6,13H2,(H,14,16) |
| InChIKey | HMJUBCXJMXZRIU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|