C11H8BrCl2N3O3 — CID 107661607
5-[(4-bromo-2,5-dichlorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 107661607) has the molecular formula C11H8BrCl2N3O3 and a molecular weight of 381.01 g/mol. Its IUPAC name is 5-[(4-bromo-2,5-dichlorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[(4-bromo-2,5-dichlorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 107661607 |
| Molecular Formula | C11H8BrCl2N3O3 |
| Molecular Weight | 381.01 g/mol |
| Exact Mass | 378.91 |
| IUPAC Name | 5-[(4-bromo-2,5-dichlorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | NNC(=O)c1cc(COc2cc(Cl)c(Br)cc2Cl)on1 |
| InChI | InChI=1S/C11H8BrCl2N3O3/c12-6-2-8(14)10(3-7(6)13)19-4-5-1-9(17-20-5)11(18)16-15/h1-3H,4,15H2,(H,16,18) |
| InChIKey | AHDVZHJFZISUDM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.01 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|