C11H6Cl3NO4 — CID 61397549
5-[(2,4,5-trichlorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 61397549) has the molecular formula C11H6Cl3NO4 and a molecular weight of 322.53 g/mol. Its IUPAC name is 5-[(2,4,5-trichlorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[(2,4,5-trichlorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 61397549 |
| Molecular Formula | C11H6Cl3NO4 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | 5-[(2,4,5-trichlorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(COc2cc(Cl)c(Cl)cc2Cl)on1 |
| InChI | InChI=1S/C11H6Cl3NO4/c12-6-2-8(14)10(3-7(6)13)18-4-5-1-9(11(16)17)15-19-5/h1-3H,4H2,(H,16,17) |
| InChIKey | PIYBRTPRCBSQRV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|