C14H13Cl3N2O2 — CID 62449798
N-[[5-[(2,4,5-trichlorophenoxy)methyl]-1,2-oxazol-3-yl]methyl]cyclopropanamine (PubChem CID 62449798) has the molecular formula C14H13Cl3N2O2 and a molecular weight of 347.63 g/mol. Its IUPAC name is N-[[5-[(2,4,5-trichlorophenoxy)methyl]-1,2-oxazol-3-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(2,4,5-trichlorophenoxy)methyl]-1,2-oxazol-3-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62449798 |
| Molecular Formula | C14H13Cl3N2O2 |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | N-[[5-[(2,4,5-trichlorophenoxy)methyl]-1,2-oxazol-3-yl]methyl]cyclopropanamine |
| SMILES | Clc1cc(Cl)c(OCc2cc(CNC3CC3)no2)cc1Cl |
| InChI | InChI=1S/C14H13Cl3N2O2/c15-11-4-13(17)14(5-12(11)16)20-7-10-3-9(19-21-10)6-18-8-1-2-8/h3-5,8,18H,1-2,6-7H2 |
| InChIKey | TUYADUDGUXURDV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|