C13H10BrCl2N3O2 — CID 107661620
6-[(4-bromo-2,5-dichlorophenoxy)methyl]pyridine-2-carbohydrazide (PubChem CID 107661620) has the molecular formula C13H10BrCl2N3O2 and a molecular weight of 391.05 g/mol. Its IUPAC name is 6-[(4-bromo-2,5-dichlorophenoxy)methyl]pyridine-2-carbohydrazide.
| Compound Name | 6-[(4-bromo-2,5-dichlorophenoxy)methyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 107661620 |
| Molecular Formula | C13H10BrCl2N3O2 |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | 6-[(4-bromo-2,5-dichlorophenoxy)methyl]pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1cccc(COc2cc(Cl)c(Br)cc2Cl)n1 |
| InChI | InChI=1S/C13H10BrCl2N3O2/c14-8-4-10(16)12(5-9(8)15)21-6-7-2-1-3-11(18-7)13(20)19-17/h1-5H,6,17H2,(H,19,20) |
| InChIKey | YIGCKFNPJYKYNW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|