C11H9F2N3O3 — CID 55214004
5-[(2,3-difluorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 55214004) has the molecular formula C11H9F2N3O3 and a molecular weight of 269.21 g/mol. Its IUPAC name is 5-[(2,3-difluorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[(2,3-difluorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 55214004 |
| Molecular Formula | C11H9F2N3O3 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 5-[(2,3-difluorophenoxy)methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | NNC(=O)c1cc(COc2cccc(F)c2F)on1 |
| InChI | InChI=1S/C11H9F2N3O3/c12-7-2-1-3-9(10(7)13)18-5-6-4-8(16-19-6)11(17)15-14/h1-4H,5,14H2,(H,15,17) |
| InChIKey | CGWWICMHVQBBNF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|