C12H13N3O5S — CID 63569829
5-[(3-methylsulfonylphenoxy)methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63569829) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is 5-[(3-methylsulfonylphenoxy)methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[(3-methylsulfonylphenoxy)methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63569829 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 5-[(3-methylsulfonylphenoxy)methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | CS(=O)(=O)c1cccc(OCc2cc(C(=O)NN)no2)c1 |
| InChI | InChI=1S/C12H13N3O5S/c1-21(17,18)10-4-2-3-8(5-10)19-7-9-6-11(15-20-9)12(16)14-13/h2-6H,7,13H2,1H3,(H,14,16) |
| InChIKey | TYVNLESAPXRHFL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|