C12H10F2O3 — CID 113372456
[5-[(2,3-difluorophenoxy)methyl]furan-2-yl]methanol (PubChem CID 113372456) has the molecular formula C12H10F2O3 and a molecular weight of 240.20 g/mol. Its IUPAC name is [5-[(2,3-difluorophenoxy)methyl]furan-2-yl]methanol.
| Compound Name | [5-[(2,3-difluorophenoxy)methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 113372456 |
| Molecular Formula | C12H10F2O3 |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | [5-[(2,3-difluorophenoxy)methyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(COc2cccc(F)c2F)o1 |
| InChI | InChI=1S/C12H10F2O3/c13-10-2-1-3-11(12(10)14)16-7-9-5-4-8(6-15)17-9/h1-5,15H,6-7H2 |
| InChIKey | LSIBIJSAWIUOSI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |