C11H9F2NO2 — CID 124587856
2-[(2,3-difluorophenoxy)methyl]-5-methyl-1,3-oxazole (PubChem CID 124587856) has the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. Its IUPAC name is 2-[(2,3-difluorophenoxy)methyl]-5-methyl-1,3-oxazole.
| Compound Name | 2-[(2,3-difluorophenoxy)methyl]-5-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 124587856 |
| Molecular Formula | C11H9F2NO2 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-[(2,3-difluorophenoxy)methyl]-5-methyl-1,3-oxazole |
| SMILES | Cc1cnc(COc2cccc(F)c2F)o1 |
| InChI | InChI=1S/C11H9F2NO2/c1-7-5-14-10(16-7)6-15-9-4-2-3-8(12)11(9)13/h2-5H,6H2,1H3 |
| InChIKey | MEVISNQKOWRVFE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |