C13H12ClF2NOS — CID 107490860
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1-benzothiophene-3-carboxamide (PubChem CID 107490860) has the molecular formula C13H12ClF2NOS and a molecular weight of 303.76 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107490860 |
| Molecular Formula | C13H12ClF2NOS |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1-benzothiophene-3-carboxamide |
| SMILES | O=C(c1csc2ccccc12)N(CCCl)CC(F)F |
| InChI | InChI=1S/C13H12ClF2NOS/c14-5-6-17(7-12(15)16)13(18)10-8-19-11-4-2-1-3-9(10)11/h1-4,8,12H,5-7H2 |
| InChIKey | RMXXYWBBGNNEAX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|