C8H10ClF2N3O — CID 107490956
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1H-pyrazole-5-carboxamide (PubChem CID 107490956) has the molecular formula C8H10ClF2N3O and a molecular weight of 237.64 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 107490956 |
| Molecular Formula | C8H10ClF2N3O |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(c1ccn[nH]1)N(CCCl)CC(F)F |
| InChI | InChI=1S/C8H10ClF2N3O/c9-2-4-14(5-7(10)11)8(15)6-1-3-12-13-6/h1,3,7H,2,4-5H2,(H,12,13) |
| InChIKey | ROVSXANEVOBFLE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|