C11H11ClF2N4O — CID 107491354
N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 107491354) has the molecular formula C11H11ClF2N4O and a molecular weight of 288.69 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 107491354 |
| Molecular Formula | C11H11ClF2N4O |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | O=C(c1cnn2ccncc12)N(CCCl)CC(F)F |
| InChI | InChI=1S/C11H11ClF2N4O/c12-1-3-17(7-10(13)14)11(19)8-5-16-18-4-2-15-6-9(8)18/h2,4-6,10H,1,3,7H2 |
| InChIKey | MGGCRASRPATALT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|