C12H13N3O — CID 103124629
2-cyclobutyl-1-pyrazolo[1,5-a]pyrazin-3-ylethanone (PubChem CID 103124629) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-cyclobutyl-1-pyrazolo[1,5-a]pyrazin-3-ylethanone.
| Compound Name | 2-cyclobutyl-1-pyrazolo[1,5-a]pyrazin-3-ylethanone |
|---|---|
| PubChem CID | 103124629 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-cyclobutyl-1-pyrazolo[1,5-a]pyrazin-3-ylethanone |
| SMILES | O=C(CC1CCC1)c1cnn2ccncc12 |
| InChI | InChI=1S/C12H13N3O/c16-12(6-9-2-1-3-9)10-7-14-15-5-4-13-8-11(10)15/h4-5,7-9H,1-3,6H2 |
| InChIKey | BAUMIKNXWUQCMJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |