C12H15N3O — CID 103128870
2-cyclobutyl-1-pyrazolo[1,5-a]pyrazin-3-ylethanol (PubChem CID 103128870) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-cyclobutyl-1-pyrazolo[1,5-a]pyrazin-3-ylethanol.
| Compound Name | 2-cyclobutyl-1-pyrazolo[1,5-a]pyrazin-3-ylethanol |
|---|---|
| PubChem CID | 103128870 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-cyclobutyl-1-pyrazolo[1,5-a]pyrazin-3-ylethanol |
| SMILES | OC(CC1CCC1)c1cnn2ccncc12 |
| InChI | InChI=1S/C12H15N3O/c16-12(6-9-2-1-3-9)10-7-14-15-5-4-13-8-11(10)15/h4-5,7-9,12,16H,1-3,6H2 |
| InChIKey | CEZQUMZTAISJDZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |