C14H19N3O — CID 103129150
cycloheptyl(pyrazolo[1,5-a]pyrazin-3-yl)methanol (PubChem CID 103129150) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is cycloheptyl(pyrazolo[1,5-a]pyrazin-3-yl)methanol.
| Compound Name | cycloheptyl(pyrazolo[1,5-a]pyrazin-3-yl)methanol |
|---|---|
| PubChem CID | 103129150 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | cycloheptyl(pyrazolo[1,5-a]pyrazin-3-yl)methanol |
| SMILES | OC(c1cnn2ccncc12)C1CCCCCC1 |
| InChI | InChI=1S/C14H19N3O/c18-14(11-5-3-1-2-4-6-11)12-9-16-17-8-7-15-10-13(12)17/h7-11,14,18H,1-6H2 |
| InChIKey | VFKVRTCKGOPVFD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |