C16H17N3O — CID 103128908
pyrazolo[1,5-a]pyrazin-3-yl-(2,4,5-trimethylphenyl)methanol (PubChem CID 103128908) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyrazin-3-yl-(2,4,5-trimethylphenyl)methanol.
| Compound Name | pyrazolo[1,5-a]pyrazin-3-yl-(2,4,5-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 103128908 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | pyrazolo[1,5-a]pyrazin-3-yl-(2,4,5-trimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2cnn3ccncc23)cc1C |
| InChI | InChI=1S/C16H17N3O/c1-10-6-12(3)13(7-11(10)2)16(20)14-8-18-19-5-4-17-9-15(14)19/h4-9,16,20H,1-3H3 |
| InChIKey | YOODUATZLWXQOG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |