C16H12N4O — CID 103129095
pyrazolo[1,5-a]pyrazin-3-yl(quinolin-5-yl)methanol (PubChem CID 103129095) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyrazin-3-yl(quinolin-5-yl)methanol.
| Compound Name | pyrazolo[1,5-a]pyrazin-3-yl(quinolin-5-yl)methanol |
|---|---|
| PubChem CID | 103129095 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | pyrazolo[1,5-a]pyrazin-3-yl(quinolin-5-yl)methanol |
| SMILES | OC(c1cccc2ncccc12)c1cnn2ccncc12 |
| InChI | InChI=1S/C16H12N4O/c21-16(13-9-19-20-8-7-17-10-15(13)20)12-3-1-5-14-11(12)4-2-6-18-14/h1-10,16,21H |
| InChIKey | OGHXXHCFAYLQCW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |