C15H11N3O2 — CID 103129234
1-benzofuran-2-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanol (PubChem CID 103129234) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1-benzofuran-2-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanol.
| Compound Name | 1-benzofuran-2-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanol |
|---|---|
| PubChem CID | 103129234 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-benzofuran-2-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanol |
| SMILES | OC(c1cc2ccccc2o1)c1cnn2ccncc12 |
| InChI | InChI=1S/C15H11N3O2/c19-15(11-8-17-18-6-5-16-9-12(11)18)14-7-10-3-1-2-4-13(10)20-14/h1-9,15,19H |
| InChIKey | GCHWPQRRNALULD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |