C16H11ClN2O2 — CID 103129244
(5-chloro-1-benzofuran-2-yl)-pyrazolo[1,5-a]pyridin-3-ylmethanol (PubChem CID 103129244) has the molecular formula C16H11ClN2O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is (5-chloro-1-benzofuran-2-yl)-pyrazolo[1,5-a]pyridin-3-ylmethanol.
| Compound Name | (5-chloro-1-benzofuran-2-yl)-pyrazolo[1,5-a]pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 103129244 |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (5-chloro-1-benzofuran-2-yl)-pyrazolo[1,5-a]pyridin-3-ylmethanol |
| SMILES | OC(c1cc2cc(Cl)ccc2o1)c1cnn2ccccc12 |
| InChI | InChI=1S/C16H11ClN2O2/c17-11-4-5-14-10(7-11)8-15(21-14)16(20)12-9-18-19-6-2-1-3-13(12)19/h1-9,16,20H |
| InChIKey | QURCPVJKOXJZRN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |