C17H14N4 — CID 103126924
naphthalen-1-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanamine (PubChem CID 103126924) has the molecular formula C17H14N4 and a molecular weight of 274.33 g/mol. Its IUPAC name is naphthalen-1-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanamine.
| Compound Name | naphthalen-1-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanamine |
|---|---|
| PubChem CID | 103126924 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | naphthalen-1-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanamine |
| SMILES | NC(c1cccc2ccccc12)c1cnn2ccncc12 |
| InChI | InChI=1S/C17H14N4/c18-17(15-10-20-21-9-8-19-11-16(15)21)14-7-3-5-12-4-1-2-6-13(12)14/h1-11,17H,18H2 |
| InChIKey | ZPBLXQVPAGRROB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |