C11H14N4O — CID 103127122
oxolan-3-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanamine (PubChem CID 103127122) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is oxolan-3-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanamine.
| Compound Name | oxolan-3-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanamine |
|---|---|
| PubChem CID | 103127122 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | oxolan-3-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanamine |
| SMILES | NC(c1cnn2ccncc12)C1CCOC1 |
| InChI | InChI=1S/C11H14N4O/c12-11(8-1-4-16-7-8)9-5-14-15-3-2-13-6-10(9)15/h2-3,5-6,8,11H,1,4,7,12H2 |
| InChIKey | OGIRAKFHOUFENW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |