C10H13ClN2O — CID 105147557
(3-chloro-4-pyridinyl)-(oxolan-3-yl)methanamine (PubChem CID 105147557) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is (3-chloro-4-pyridinyl)-(oxolan-3-yl)methanamine.
| Compound Name | (3-chloro-4-pyridinyl)-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 105147557 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (3-chloro-4-pyridinyl)-(oxolan-3-yl)methanamine |
| SMILES | NC(c1ccncc1Cl)C1CCOC1 |
| InChI | InChI=1S/C10H13ClN2O/c11-9-5-13-3-1-8(9)10(12)7-2-4-14-6-7/h1,3,5,7,10H,2,4,6,12H2 |
| InChIKey | CQCGIIRBAFFKDU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |