C7H7ClF2N2 — CID 131150469
(1R)-1-(3-chloro-4-pyridinyl)-2,2-difluoroethanamine (PubChem CID 131150469) has the molecular formula C7H7ClF2N2 and a molecular weight of 192.60 g/mol. Its IUPAC name is (1R)-1-(3-chloro-4-pyridinyl)-2,2-difluoroethanamine.
| Compound Name | (1R)-1-(3-chloro-4-pyridinyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 131150469 |
| Molecular Formula | C7H7ClF2N2 |
| Molecular Weight | 192.60 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | (1R)-1-(3-chloro-4-pyridinyl)-2,2-difluoroethanamine |
| SMILES | N[C@H](c1ccncc1Cl)C(F)F |
| InChI | InChI=1S/C7H7ClF2N2/c8-5-3-12-2-1-4(5)6(11)7(9)10/h1-3,6-7H,11H2/t6-/m1/s1 |
| InChIKey | ZPNXEZUFFZVWAS-ZCFIWIBFSA-N |
| XLogP | 2.00 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.60 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |