C11H16Cl2N2O — CID 171239096
(S)-(3-chloro-4-pyridinyl)-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171239096) has the molecular formula C11H16Cl2N2O and a molecular weight of 263.17 g/mol. Its IUPAC name is (S)-(3-chloro-4-pyridinyl)-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (S)-(3-chloro-4-pyridinyl)-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171239096 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (S)-(3-chloro-4-pyridinyl)-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccncc1Cl)C1CCOCC1 |
| InChI | InChI=1S/C11H15ClN2O.ClH/c12-10-7-14-4-1-9(10)11(13)8-2-5-15-6-3-8;/h1,4,7-8,11H,2-3,5-6,13H2;1H/t11-;/m0./s1 |
| InChIKey | SDQNPYXNVHWVKS-MERQFXBCSA-N |
| XLogP | 2.58 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |