C12H17N5O — CID 107139918
[oxan-3-yl(pyrazolo[1,5-a]pyrazin-3-yl)methyl]hydrazine (PubChem CID 107139918) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is [oxan-3-yl(pyrazolo[1,5-a]pyrazin-3-yl)methyl]hydrazine.
| Compound Name | [oxan-3-yl(pyrazolo[1,5-a]pyrazin-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107139918 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | [oxan-3-yl(pyrazolo[1,5-a]pyrazin-3-yl)methyl]hydrazine |
| SMILES | NNC(c1cnn2ccncc12)C1CCCOC1 |
| InChI | InChI=1S/C12H17N5O/c13-16-12(9-2-1-5-18-8-9)10-6-15-17-4-3-14-7-11(10)17/h3-4,6-7,9,12,16H,1-2,5,8,13H2 |
| InChIKey | LVIRPXICFARRFM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|