C10H18N4O — CID 105306569
[(1,5-dimethylpyrazol-4-yl)-(oxolan-3-yl)methyl]hydrazine (PubChem CID 105306569) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is [(1,5-dimethylpyrazol-4-yl)-(oxolan-3-yl)methyl]hydrazine.
| Compound Name | [(1,5-dimethylpyrazol-4-yl)-(oxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105306569 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | [(1,5-dimethylpyrazol-4-yl)-(oxolan-3-yl)methyl]hydrazine |
| SMILES | Cc1c(C(NN)C2CCOC2)cnn1C |
| InChI | InChI=1S/C10H18N4O/c1-7-9(5-12-14(7)2)10(13-11)8-3-4-15-6-8/h5,8,10,13H,3-4,6,11H2,1-2H3 |
| InChIKey | WBQDTECEFCWLEX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|