C9H16N4O — CID 105228611
[(1-methylpyrazol-3-yl)-(oxolan-3-yl)methyl]hydrazine (PubChem CID 105228611) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is [(1-methylpyrazol-3-yl)-(oxolan-3-yl)methyl]hydrazine.
| Compound Name | [(1-methylpyrazol-3-yl)-(oxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105228611 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | [(1-methylpyrazol-3-yl)-(oxolan-3-yl)methyl]hydrazine |
| SMILES | Cn1ccc(C(NN)C2CCOC2)n1 |
| InChI | InChI=1S/C9H16N4O/c1-13-4-2-8(12-13)9(11-10)7-3-5-14-6-7/h2,4,7,9,11H,3,5-6,10H2,1H3 |
| InChIKey | WODNROODWZSBOS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|