C8H13N3OS — CID 130604763
[oxolan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine (PubChem CID 130604763) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is [oxolan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine.
| Compound Name | [oxolan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 130604763 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | [oxolan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine |
| SMILES | NNC(c1ccsn1)C1CCOC1 |
| InChI | InChI=1S/C8H13N3OS/c9-10-8(6-1-3-12-5-6)7-2-4-13-11-7/h2,4,6,8,10H,1,3,5,9H2 |
| InChIKey | VHUVVIBCGKARBL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|